C21H19N7O3 — CID 122289366
2-(1,3-dioxoisoindol-2-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]acetamide (PubChem CID 122289366) has the molecular formula C21H19N7O3 and a molecular weight of 417.43 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122289366 |
| Molecular Formula | C21H19N7O3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NCCNc1ccc(Nc2cccnc2)nn1 |
| InChI | InChI=1S/C21H19N7O3/c29-19(13-28-20(30)15-5-1-2-6-16(15)21(28)31)24-11-10-23-17-7-8-18(27-26-17)25-14-4-3-9-22-12-14/h1-9,12H,10-11,13H2,(H,23,26)(H,24,29)(H,25,27) |
| InChIKey | JGNIKKDDIXCIQN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|