C19H18N6O3 — CID 121066468
N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 121066468) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 121066468 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCNc1ccc(Nc2cccnc2)nn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N6O3/c26-19(13-3-4-15-16(10-13)28-12-27-15)22-9-8-21-17-5-6-18(25-24-17)23-14-2-1-7-20-11-14/h1-7,10-11H,8-9,12H2,(H,21,24)(H,22,26)(H,23,25) |
| InChIKey | XVVCILBXOJTHFC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|