C20H20N6O3 — CID 42111726
N-[2-[[6-[(6-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42111726) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[2-[[6-[(6-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[[6-[(6-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42111726 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[2-[[6-[(6-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1cccc(Nc2ccc(NCCNC(=O)c3ccc4c(c3)OCO4)nn2)n1 |
| InChI | InChI=1S/C20H20N6O3/c1-13-3-2-4-18(23-13)24-19-8-7-17(25-26-19)21-9-10-22-20(27)14-5-6-15-16(11-14)29-12-28-15/h2-8,11H,9-10,12H2,1H3,(H,21,25)(H,22,27)(H,23,24,26) |
| InChIKey | UKQZZUURQZAUES-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|