C20H22N6O — CID 56699027
3,4-dimethyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzamide (PubChem CID 56699027) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 56699027 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 3,4-dimethyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCNc2ccc(Nc3ccncc3)nn2)cc1C |
| InChI | InChI=1S/C20H22N6O/c1-14-3-4-16(13-15(14)2)20(27)23-12-11-22-18-5-6-19(26-25-18)24-17-7-9-21-10-8-17/h3-10,13H,11-12H2,1-2H3,(H,22,25)(H,23,27)(H,21,24,26) |
| InChIKey | LQLKZLNWMJNHCC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|