C20H23N7O — CID 121065114
1-(3,5-dimethylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea (PubChem CID 121065114) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121065114 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea |
| SMILES | Cc1cc(C)cc(NC(=O)NCCNc2ccc(Nc3ccncc3)nn2)c1 |
| InChI | InChI=1S/C20H23N7O/c1-14-11-15(2)13-17(12-14)25-20(28)23-10-9-22-18-3-4-19(27-26-18)24-16-5-7-21-8-6-16/h3-8,11-13H,9-10H2,1-2H3,(H,22,26)(H,21,24,27)(H2,23,25,28) |
| InChIKey | TUFAHVZHRZNVEU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|