C19H18F3N7O2 — CID 122289048
1-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 122289048) has the molecular formula C19H18F3N7O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is 1-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122289048 |
| Molecular Formula | C19H18F3N7O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(NCCNc1ccc(Nc2ccncc2)nn1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N7O2/c20-19(21,22)31-15-3-1-13(2-4-15)27-18(30)25-12-11-24-16-5-6-17(29-28-16)26-14-7-9-23-10-8-14/h1-10H,11-12H2,(H,24,28)(H,23,26,29)(H2,25,27,30) |
| InChIKey | VHBUAHZKTIYDGC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|