C22H27N7O — CID 122289294
1-(4-tert-butylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea (PubChem CID 122289294) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122289294 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCNc2ccc(Nc3ccncc3)nn2)cc1 |
| InChI | InChI=1S/C22H27N7O/c1-22(2,3)16-4-6-17(7-5-16)27-21(30)25-15-14-24-19-8-9-20(29-28-19)26-18-10-12-23-13-11-18/h4-13H,14-15H2,1-3H3,(H,24,28)(H,23,26,29)(H2,25,27,30) |
| InChIKey | XDNUQLLNSYMLNC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|