C19H20FN7O — CID 121065120
1-(3-fluoro-4-methylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea (PubChem CID 121065120) has the molecular formula C19H20FN7O and a molecular weight of 381.42 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121065120 |
| Molecular Formula | C19H20FN7O |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCNc2ccc(Nc3ccncc3)nn2)cc1F |
| InChI | InChI=1S/C19H20FN7O/c1-13-2-3-15(12-16(13)20)25-19(28)23-11-10-22-17-4-5-18(27-26-17)24-14-6-8-21-9-7-14/h2-9,12H,10-11H2,1H3,(H,22,26)(H,21,24,27)(H2,23,25,28) |
| InChIKey | OBWLJFFXABRMBP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|