C18H19FN6O — CID 71799952
1-(3-fluoro-4-methylphenyl)-3-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]urea (PubChem CID 71799952) has the molecular formula C18H19FN6O and a molecular weight of 354.39 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]urea.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 71799952 |
| Molecular Formula | C18H19FN6O |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCNc2ccc(-n3cccc3)nn2)cc1F |
| InChI | InChI=1S/C18H19FN6O/c1-13-4-5-14(12-15(13)19)22-18(26)21-9-8-20-16-6-7-17(24-23-16)25-10-2-3-11-25/h2-7,10-12H,8-9H2,1H3,(H,20,23)(H2,21,22,26) |
| InChIKey | RPQNOOBFQJXMAH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|