C18H21N7OS — CID 122327145
1-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 122327145) has the molecular formula C18H21N7OS and a molecular weight of 383.48 g/mol. Its IUPAC name is 1-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 122327145 |
| Molecular Formula | C18H21N7OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NCCNc2ccc(-n3ccc(C)n3)nn2)c1 |
| InChI | InChI=1S/C18H21N7OS/c1-13-8-11-25(24-13)17-7-6-16(22-23-17)19-9-10-20-18(26)21-14-4-3-5-15(12-14)27-2/h3-8,11-12H,9-10H2,1-2H3,(H,19,22)(H2,20,21,26) |
| InChIKey | IQQDNWDTUNCWBT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|