C19H22N6O — CID 122327087
N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-phenylpropanamide (PubChem CID 122327087) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 122327087 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-phenylpropanamide |
| SMILES | Cc1ccn(-c2ccc(NCCNC(=O)CCc3ccccc3)nn2)n1 |
| InChI | InChI=1S/C19H22N6O/c1-15-11-14-25(24-15)18-9-8-17(22-23-18)20-12-13-21-19(26)10-7-16-5-3-2-4-6-16/h2-6,8-9,11,14H,7,10,12-13H2,1H3,(H,20,22)(H,21,26) |
| InChIKey | DDXGNHQOANEJKW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|