C19H19N7O — CID 122327290
N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]indolizine-2-carboxamide (PubChem CID 122327290) has the molecular formula C19H19N7O and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]indolizine-2-carboxamide.
| Compound Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]indolizine-2-carboxamide |
|---|---|
| PubChem CID | 122327290 |
| Molecular Formula | C19H19N7O |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]indolizine-2-carboxamide |
| SMILES | Cc1ccn(-c2ccc(NCCNC(=O)c3cc4ccccn4c3)nn2)n1 |
| InChI | InChI=1S/C19H19N7O/c1-14-7-11-26(24-14)18-6-5-17(22-23-18)20-8-9-21-19(27)15-12-16-4-2-3-10-25(16)13-15/h2-7,10-13H,8-9H2,1H3,(H,20,22)(H,21,27) |
| InChIKey | UYSRRZVREGGYHE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|