C21H20N6OS — CID 122327261
N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-4-thiophen-2-ylbenzamide (PubChem CID 122327261) has the molecular formula C21H20N6OS and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 122327261 |
| Molecular Formula | C21H20N6OS |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-4-thiophen-2-ylbenzamide |
| SMILES | Cc1ccn(-c2ccc(NCCNC(=O)c3ccc(-c4cccs4)cc3)nn2)n1 |
| InChI | InChI=1S/C21H20N6OS/c1-15-10-13-27(26-15)20-9-8-19(24-25-20)22-11-12-23-21(28)17-6-4-16(5-7-17)18-3-2-14-29-18/h2-10,13-14H,11-12H2,1H3,(H,22,24)(H,23,28) |
| InChIKey | NGYGOWZWRQXWKP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|