C20H18N6O3 — CID 122327100
N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-oxochromene-3-carboxamide (PubChem CID 122327100) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 122327100 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1ccn(-c2ccc(NCCNC(=O)c3cc4ccccc4oc3=O)nn2)n1 |
| InChI | InChI=1S/C20H18N6O3/c1-13-8-11-26(25-13)18-7-6-17(23-24-18)21-9-10-22-19(27)15-12-14-4-2-3-5-16(14)29-20(15)28/h2-8,11-12H,9-10H2,1H3,(H,21,23)(H,22,27) |
| InChIKey | JFXCNHOLRWQKRX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|