C15H13N3O3 — CID 110742740
2-oxo-N-(2-pyrazol-1-ylethyl)chromene-3-carboxamide (PubChem CID 110742740) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-oxo-N-(2-pyrazol-1-ylethyl)chromene-3-carboxamide.
| Compound Name | 2-oxo-N-(2-pyrazol-1-ylethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 110742740 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-oxo-N-(2-pyrazol-1-ylethyl)chromene-3-carboxamide |
| SMILES | O=C(NCCn1cccn1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C15H13N3O3/c19-14(16-7-9-18-8-3-6-17-18)12-10-11-4-1-2-5-13(11)21-15(12)20/h1-6,8,10H,7,9H2,(H,16,19) |
| InChIKey | CEDVBEARJSMZEK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|