C15H15N7O4 — CID 122327152
N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-5-nitrofuran-2-carboxamide (PubChem CID 122327152) has the molecular formula C15H15N7O4 and a molecular weight of 357.33 g/mol. Its IUPAC name is N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 122327152 |
| Molecular Formula | C15H15N7O4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-5-nitrofuran-2-carboxamide |
| SMILES | Cc1ccn(-c2ccc(NCCNC(=O)c3ccc([N+](=O)[O-])o3)nn2)n1 |
| InChI | InChI=1S/C15H15N7O4/c1-10-6-9-21(20-10)13-4-3-12(18-19-13)16-7-8-17-15(23)11-2-5-14(26-11)22(24)25/h2-6,9H,7-8H2,1H3,(H,16,18)(H,17,23) |
| InChIKey | BQJJJMNUPYZRQS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|