C17H17N7O4 — CID 122288549
N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-5-nitrofuran-2-carboxamide (PubChem CID 122288549) has the molecular formula C17H17N7O4 and a molecular weight of 383.37 g/mol. Its IUPAC name is N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 122288549 |
| Molecular Formula | C17H17N7O4 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-5-nitrofuran-2-carboxamide |
| SMILES | Cc1ccnc(Nc2ccc(NCCNC(=O)c3ccc([N+](=O)[O-])o3)nn2)c1 |
| InChI | InChI=1S/C17H17N7O4/c1-11-6-7-18-15(10-11)21-14-4-3-13(22-23-14)19-8-9-20-17(25)12-2-5-16(28-12)24(26)27/h2-7,10H,8-9H2,1H3,(H,19,22)(H,20,25)(H,18,21,23) |
| InChIKey | FFUZXQGZTCJCOW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|