C25H23FN6O2 — CID 122288707
3-(4-fluorophenoxy)-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzamide (PubChem CID 122288707) has the molecular formula C25H23FN6O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzamide.
| Compound Name | 3-(4-fluorophenoxy)-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122288707 |
| Molecular Formula | C25H23FN6O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 3-(4-fluorophenoxy)-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzamide |
| SMILES | Cc1ccnc(Nc2ccc(NCCNC(=O)c3cccc(Oc4ccc(F)cc4)c3)nn2)c1 |
| InChI | InChI=1S/C25H23FN6O2/c1-17-11-12-27-24(15-17)30-23-10-9-22(31-32-23)28-13-14-29-25(33)18-3-2-4-21(16-18)34-20-7-5-19(26)6-8-20/h2-12,15-16H,13-14H2,1H3,(H,28,31)(H,29,33)(H,27,30,32) |
| InChIKey | WQQMAUJZPTYDQO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|