C21H24N6O — CID 121064501
2,4-dimethyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzamide (PubChem CID 121064501) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121064501 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2,4-dimethyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzamide |
| SMILES | Cc1ccnc(Nc2ccc(NCCNC(=O)c3ccc(C)cc3C)nn2)c1 |
| InChI | InChI=1S/C21H24N6O/c1-14-4-5-17(16(3)12-14)21(28)24-11-10-23-18-6-7-19(27-26-18)25-20-13-15(2)8-9-22-20/h4-9,12-13H,10-11H2,1-3H3,(H,23,26)(H,24,28)(H,22,25,27) |
| InChIKey | PIOFUIXWMAYCTC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|