C22H30N6O — CID 122327239
2-(1-adamantyl)-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]acetamide (PubChem CID 122327239) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122327239 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]acetamide |
| SMILES | Cc1ccn(-c2ccc(NCCNC(=O)CC34CC5CC(CC(C5)C3)C4)nn2)n1 |
| InChI | InChI=1S/C22H30N6O/c1-15-4-7-28(27-15)20-3-2-19(25-26-20)23-5-6-24-21(29)14-22-11-16-8-17(12-22)10-18(9-16)13-22/h2-4,7,16-18H,5-6,8-14H2,1H3,(H,23,25)(H,24,29) |
| InChIKey | FYBXVYLITJGXEX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|