C16H21N7O2 — CID 122327269
N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-6-oxopiperidine-3-carboxamide (PubChem CID 122327269) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 122327269 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1ccn(-c2ccc(NCCNC(=O)C3CCC(=O)NC3)nn2)n1 |
| InChI | InChI=1S/C16H21N7O2/c1-11-6-9-23(22-11)14-4-3-13(20-21-14)17-7-8-18-16(25)12-2-5-15(24)19-10-12/h3-4,6,9,12H,2,5,7-8,10H2,1H3,(H,17,20)(H,18,25)(H,19,24) |
| InChIKey | PFEIUHIZOCTPSL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|