C16H23N7O3S — CID 122292675
1-methylsulfonyl-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]piperidine-4-carboxamide (PubChem CID 122292675) has the molecular formula C16H23N7O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 122292675 |
| Molecular Formula | C16H23N7O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-methylsulfonyl-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)NCCNc2ccc(-n3cccn3)nn2)CC1 |
| InChI | InChI=1S/C16H23N7O3S/c1-27(25,26)22-11-5-13(6-12-22)16(24)18-9-8-17-14-3-4-15(21-20-14)23-10-2-7-19-23/h2-4,7,10,13H,5-6,8-9,11-12H2,1H3,(H,17,20)(H,18,24) |
| InChIKey | YYVGGHJHFCHKCW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|