About 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine
1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine (PubChem CID 7537518) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine.
Analyze 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine?
The IUPAC name of 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine (CID 7537518) is 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine?
The canonical SMILES for 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine is CNCc1cc(-c2ccco2)on1.
What is the InChIKey of 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine?
The InChIKey is CQBVGZVXQOWFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-10-6-7-5-9(13-11-7)8-3-2-4-12-8/h2-5,10H,6H2,1H3.
What are the key properties of 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine?
1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine has a molecular weight of 178.19 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-methylmethanamine is sourced from PubChem (CID 7537518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).