C8H8N2O2 — CID 7060533
[5-(furan-2-yl)-1,2-oxazol-3-yl]methanamine (PubChem CID 7060533) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,2-oxazol-3-yl]methanamine.
| Compound Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methanamine |
|---|---|
| PubChem CID | 7060533 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methanamine |
| SMILES | NCc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C8H8N2O2/c9-5-6-4-8(12-10-6)7-2-1-3-11-7/h1-4H,5,9H2 |
| InChIKey | IKOFHZGPFRNEQZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |