C22H15NO5 — CID 8808452
[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 4-benzoylbenzoate (PubChem CID 8808452) has the molecular formula C22H15NO5 and a molecular weight of 373.36 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 4-benzoylbenzoate.
| Compound Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 4-benzoylbenzoate |
|---|---|
| PubChem CID | 8808452 |
| Molecular Formula | C22H15NO5 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 4-benzoylbenzoate |
| SMILES | O=C(OCc1cc(-c2ccco2)on1)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H15NO5/c24-21(15-5-2-1-3-6-15)16-8-10-17(11-9-16)22(25)27-14-18-13-20(28-23-18)19-7-4-12-26-19/h1-13H,14H2 |
| InChIKey | XJGKATKQTTVGQL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |