C23H18N2O5 — CID 8809666
[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-[(2-phenylacetyl)amino]benzoate (PubChem CID 8809666) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-[(2-phenylacetyl)amino]benzoate.
| Compound Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-[(2-phenylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 8809666 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-[(2-phenylacetyl)amino]benzoate |
| SMILES | O=C(Cc1ccccc1)Nc1ccccc1C(=O)OCc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C23H18N2O5/c26-22(13-16-7-2-1-3-8-16)24-19-10-5-4-9-18(19)23(27)29-15-17-14-21(30-25-17)20-11-6-12-28-20/h1-12,14H,13,15H2,(H,24,26) |
| InChIKey | GSLBKOKORSJLSK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |