C18H16N2O5S — CID 24530422
(5-phenyl-1,2-oxazol-3-yl)methyl 2-(methanesulfonamido)benzoate (PubChem CID 24530422) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is (5-phenyl-1,2-oxazol-3-yl)methyl 2-(methanesulfonamido)benzoate.
| Compound Name | (5-phenyl-1,2-oxazol-3-yl)methyl 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 24530422 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (5-phenyl-1,2-oxazol-3-yl)methyl 2-(methanesulfonamido)benzoate |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)OCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C18H16N2O5S/c1-26(22,23)20-16-10-6-5-9-15(16)18(21)24-12-14-11-17(25-19-14)13-7-3-2-4-8-13/h2-11,20H,12H2,1H3 |
| InChIKey | RNJUUJOUSFIXED-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |