C17H13N3O5 — CID 24527354
(5-phenyl-1,2-oxazol-3-yl)methyl 2-amino-5-nitrobenzoate (PubChem CID 24527354) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is (5-phenyl-1,2-oxazol-3-yl)methyl 2-amino-5-nitrobenzoate.
| Compound Name | (5-phenyl-1,2-oxazol-3-yl)methyl 2-amino-5-nitrobenzoate |
|---|---|
| PubChem CID | 24527354 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (5-phenyl-1,2-oxazol-3-yl)methyl 2-amino-5-nitrobenzoate |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(=O)OCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C17H13N3O5/c18-15-7-6-13(20(22)23)9-14(15)17(21)24-10-12-8-16(25-19-12)11-4-2-1-3-5-11/h1-9H,10,18H2 |
| InChIKey | LVUXRWPVLYLHEB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|