C16H12N2O4 — CID 9013397
3-[(2-nitrophenoxy)methyl]-5-phenyl-1,2-oxazole (PubChem CID 9013397) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 3-[(2-nitrophenoxy)methyl]-5-phenyl-1,2-oxazole.
| Compound Name | 3-[(2-nitrophenoxy)methyl]-5-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 9013397 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-[(2-nitrophenoxy)methyl]-5-phenyl-1,2-oxazole |
| SMILES | O=[N+]([O-])c1ccccc1OCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H12N2O4/c19-18(20)14-8-4-5-9-15(14)21-11-13-10-16(22-17-13)12-6-2-1-3-7-12/h1-10H,11H2 |
| InChIKey | RICXGLPSEAKILK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|