C17H14N2O4 — CID 41459120
2-[(5-methyl-2-nitrophenoxy)methyl]-5-phenyl-1,3-oxazole (PubChem CID 41459120) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-[(5-methyl-2-nitrophenoxy)methyl]-5-phenyl-1,3-oxazole.
| Compound Name | 2-[(5-methyl-2-nitrophenoxy)methyl]-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 41459120 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[(5-methyl-2-nitrophenoxy)methyl]-5-phenyl-1,3-oxazole |
| SMILES | Cc1ccc([N+](=O)[O-])c(OCc2ncc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C17H14N2O4/c1-12-7-8-14(19(20)21)15(9-12)22-11-17-18-10-16(23-17)13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | LQTQVHRADUDILL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|