C17H12N2O5 — CID 9454725
(5-phenyl-1,3-oxazol-2-yl)methyl 2-nitrobenzoate (PubChem CID 9454725) has the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 2-nitrobenzoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-nitrobenzoate |
|---|---|
| PubChem CID | 9454725 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-nitrobenzoate |
| SMILES | O=C(OCc1ncc(-c2ccccc2)o1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12N2O5/c20-17(13-8-4-5-9-14(13)19(21)22)23-11-16-18-10-15(24-16)12-6-2-1-3-7-12/h1-10H,11H2 |
| InChIKey | RTZHVUUBUOVHHM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|