C18H14FNO4 — CID 8509326
(5-phenyl-1,3-oxazol-2-yl)methyl 2-fluoro-4-methoxybenzoate (PubChem CID 8509326) has the molecular formula C18H14FNO4 and a molecular weight of 327.31 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 2-fluoro-4-methoxybenzoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8509326 |
| Molecular Formula | C18H14FNO4 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2ncc(-c3ccccc3)o2)c(F)c1 |
| InChI | InChI=1S/C18H14FNO4/c1-22-13-7-8-14(15(19)9-13)18(21)23-11-17-20-10-16(24-17)12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | HRDRSCNAJGTWDJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |