C25H21NO5 — CID 18205556
(5-phenyl-1,3-oxazol-2-yl)methyl 2-(2-phenoxyethoxy)benzoate (PubChem CID 18205556) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 2-(2-phenoxyethoxy)benzoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-(2-phenoxyethoxy)benzoate |
|---|---|
| PubChem CID | 18205556 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-(2-phenoxyethoxy)benzoate |
| SMILES | O=C(OCc1ncc(-c2ccccc2)o1)c1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C25H21NO5/c27-25(30-18-24-26-17-23(31-24)19-9-3-1-4-10-19)21-13-7-8-14-22(21)29-16-15-28-20-11-5-2-6-12-20/h1-14,17H,15-16,18H2 |
| InChIKey | WEUOUMAVDZUURP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|