4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid

C15H11NO5 — CID 43214757

IUPAC4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid
SMILESO=C(O)c1ccc(OCc2cc(-c3ccco3)on2)cc1
InChIInChI=1S/C15H11NO5/c17-15(18)10-3-5-12(6-4-10)20-9-11-8-14(21-16-11)13-2-1-7-19-13/h1-8H,9H2,(H,17,18)
InChIKeyADMHHSOZMKPHQM-UHFFFAOYSA-N
MW285.26 g/mol
LogP3.21
Rot. Bonds5

About 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid

4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid (PubChem CID 43214757) has the molecular formula C15H11NO5 and a molecular weight of 285.26 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid.

Molecular Properties

Compound Name4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid
PubChem CID43214757
Molecular FormulaC15H11NO5
Molecular Weight285.26 g/mol
Exact Mass285.06
IUPAC Name4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid
SMILESO=C(O)c1ccc(OCc2cc(-c3ccco3)on2)cc1
InChIInChI=1S/C15H11NO5/c17-15(18)10-3-5-12(6-4-10)20-9-11-8-14(21-16-11)13-2-1-7-19-13/h1-8H,9H2,(H,17,18)
InChIKeyADMHHSOZMKPHQM-UHFFFAOYSA-N
XLogP3.21
TPSA85.70 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.26
LogP ≤ 53.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid?
The IUPAC name of 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid (CID 43214757) is 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid.
What is the SMILES notation for 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid?
The canonical SMILES for 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid is O=C(O)c1ccc(OCc2cc(-c3ccco3)on2)cc1.
What is the InChIKey of 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid?
The InChIKey is ADMHHSOZMKPHQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO5/c17-15(18)10-3-5-12(6-4-10)20-9-11-8-14(21-16-11)13-2-1-7-19-13/h1-8H,9H2,(H,17,18).
What are the key properties of 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid?
4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid has a molecular weight of 285.26 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]benzoic acid is sourced from PubChem (CID 43214757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).