C15H11N5O3 — CID 26676390
5-(furan-2-yl)-3-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,2-oxazole (PubChem CID 26676390) has the molecular formula C15H11N5O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,2-oxazole.
| Compound Name | 5-(furan-2-yl)-3-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 26676390 |
| Molecular Formula | C15H11N5O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-(furan-2-yl)-3-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,2-oxazole |
| SMILES | c1coc(-c2cc(COc3ccc(-n4cnnn4)cc3)no2)c1 |
| InChI | InChI=1S/C15H11N5O3/c1-2-14(21-7-1)15-8-11(17-23-15)9-22-13-5-3-12(4-6-13)20-10-16-18-19-20/h1-8,10H,9H2 |
| InChIKey | ZRPOXVBHIDMQJV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |