C17H17NO3 — CID 112797313
5-(furan-2-yl)-3-[(2,3,5-trimethylphenoxy)methyl]-1,2-oxazole (PubChem CID 112797313) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[(2,3,5-trimethylphenoxy)methyl]-1,2-oxazole.
| Compound Name | 5-(furan-2-yl)-3-[(2,3,5-trimethylphenoxy)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 112797313 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-(furan-2-yl)-3-[(2,3,5-trimethylphenoxy)methyl]-1,2-oxazole |
| SMILES | Cc1cc(C)c(C)c(OCc2cc(-c3ccco3)on2)c1 |
| InChI | InChI=1S/C17H17NO3/c1-11-7-12(2)13(3)16(8-11)20-10-14-9-17(21-18-14)15-5-4-6-19-15/h4-9H,10H2,1-3H3 |
| InChIKey | KCLKFCLANMGGFP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 48.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |