C16H14N2O5 — CID 18089227
2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-4-methoxybenzamide (PubChem CID 18089227) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-4-methoxybenzamide.
| Compound Name | 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18089227 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)c(OCc2cc(-c3ccco3)on2)c1 |
| InChI | InChI=1S/C16H14N2O5/c1-20-11-4-5-12(16(17)19)14(8-11)22-9-10-7-15(23-18-10)13-3-2-6-21-13/h2-8H,9H2,1H3,(H2,17,19) |
| InChIKey | FEQHZODVACUKDE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |