C16H14N2O4S — CID 18166113
4-methoxy-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzamide (PubChem CID 18166113) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is 4-methoxy-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzamide.
| Compound Name | 4-methoxy-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 18166113 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-methoxy-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzamide |
| SMILES | COc1ccc(C(N)=O)c(OCc2coc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C16H14N2O4S/c1-20-11-4-5-12(15(17)19)13(7-11)21-8-10-9-22-16(18-10)14-3-2-6-23-14/h2-7,9H,8H2,1H3,(H2,17,19) |
| InChIKey | DHRMPAVRWCUJSS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |