C18H16N2O8 — CID 9125316
[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 9125316) has the molecular formula C18H16N2O8 and a molecular weight of 388.33 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 9125316 |
| Molecular Formula | C18H16N2O8 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OCc2cc(-c3ccco3)on2)cc1OC |
| InChI | InChI=1S/C18H16N2O8/c1-3-25-16-9-13(20(22)23)12(8-15(16)24-2)18(21)27-10-11-7-17(28-19-11)14-5-4-6-26-14/h4-9H,3,10H2,1-2H3 |
| InChIKey | VEAIEOYFDZGAPE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 127.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|