C14H11NO3S — CID 47298267
4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]phenol (PubChem CID 47298267) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]phenol.
| Compound Name | 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 47298267 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]phenol |
| SMILES | Oc1ccc(SCc2cc(-c3ccco3)on2)cc1 |
| InChI | InChI=1S/C14H11NO3S/c16-11-3-5-12(6-4-11)19-9-10-8-14(18-15-10)13-2-1-7-17-13/h1-8,16H,9H2 |
| InChIKey | QFTWBYLMTFCKCJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |