C15H13N3O5S — CID 24669152
5-(furan-2-yl)-N-[4-(sulfamoylmethyl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 24669152) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[4-(sulfamoylmethyl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[4-(sulfamoylmethyl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24669152 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-(furan-2-yl)-N-[4-(sulfamoylmethyl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)c2cc(-c3ccco3)on2)cc1 |
| InChI | InChI=1S/C15H13N3O5S/c16-24(20,21)9-10-3-5-11(6-4-10)17-15(19)12-8-14(23-18-12)13-2-1-7-22-13/h1-8H,9H2,(H,17,19)(H2,16,20,21) |
| InChIKey | JARMBNIAOYYJQZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |