C16H14N2O5 — CID 24663728
N-(2,5-dimethoxyphenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 24663728) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24663728 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc(-c3ccco3)on2)c1 |
| InChI | InChI=1S/C16H14N2O5/c1-20-10-5-6-13(21-2)11(8-10)17-16(19)12-9-15(23-18-12)14-4-3-7-22-14/h3-9H,1-2H3,(H,17,19) |
| InChIKey | FBDOBBHFCZOTRB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |