C16H16N2O5 — CID 46394490
methyl 6-[(2,5-dimethoxyphenyl)carbamoyl]pyridine-2-carboxylate (PubChem CID 46394490) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is methyl 6-[(2,5-dimethoxyphenyl)carbamoyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[(2,5-dimethoxyphenyl)carbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 46394490 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | methyl 6-[(2,5-dimethoxyphenyl)carbamoyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2cc(OC)ccc2OC)n1 |
| InChI | InChI=1S/C16H16N2O5/c1-21-10-7-8-14(22-2)13(9-10)18-15(19)11-5-4-6-12(17-11)16(20)23-3/h4-9H,1-3H3,(H,18,19) |
| InChIKey | RYNOXBCLVOATCC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |