C14H15N3O3 — CID 62241119
6-amino-N-(2,5-dimethoxyphenyl)pyridine-2-carboxamide (PubChem CID 62241119) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 6-amino-N-(2,5-dimethoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 6-amino-N-(2,5-dimethoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62241119 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-amino-N-(2,5-dimethoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccc(N)n2)c1 |
| InChI | InChI=1S/C14H15N3O3/c1-19-9-6-7-12(20-2)11(8-9)17-14(18)10-4-3-5-13(15)16-10/h3-8H,1-2H3,(H2,15,16)(H,17,18) |
| InChIKey | LAJVOPGWIPINQQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |