C21H18FN3O4 — CID 109100738
6-N-(2,5-dimethoxyphenyl)-2-N-(2-fluorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 109100738) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is 6-N-(2,5-dimethoxyphenyl)-2-N-(2-fluorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(2,5-dimethoxyphenyl)-2-N-(2-fluorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109100738 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 6-N-(2,5-dimethoxyphenyl)-2-N-(2-fluorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccc(C(=O)Nc3ccccc3F)n2)c1 |
| InChI | InChI=1S/C21H18FN3O4/c1-28-13-10-11-19(29-2)18(12-13)25-21(27)17-9-5-8-16(23-17)20(26)24-15-7-4-3-6-14(15)22/h3-12H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | KZKPISOSWPQVDN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |