C15H17N3O3 — CID 110860509
N-(2,5-dimethoxyphenyl)-2,6-dimethylpyrimidine-4-carboxamide (PubChem CID 110860509) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2,6-dimethylpyrimidine-4-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2,6-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110860509 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2,6-dimethylpyrimidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc(C)nc(C)n2)c1 |
| InChI | InChI=1S/C15H17N3O3/c1-9-7-13(17-10(2)16-9)15(19)18-12-8-11(20-3)5-6-14(12)21-4/h5-8H,1-4H3,(H,18,19) |
| InChIKey | APDJRZWTWVCNAY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |