C12H12N2O3S — CID 36708538
[2-(furan-2-yl)-1,3-thiazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 36708538) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-thiazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 36708538 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1csc(-c2ccco2)n1)N1CCOCC1 |
| InChI | InChI=1S/C12H12N2O3S/c15-12(14-3-6-16-7-4-14)9-8-18-11(13-9)10-2-1-5-17-10/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | ISBYNIBRHRGKRU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |