C12H13N3O2S — CID 82515785
[2-(furan-2-yl)-1,3-thiazol-4-yl]-piperazin-1-ylmethanone (PubChem CID 82515785) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-thiazol-4-yl]-piperazin-1-ylmethanone.
| Compound Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 82515785 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1csc(-c2ccco2)n1)N1CCNCC1 |
| InChI | InChI=1S/C12H13N3O2S/c16-12(15-5-3-13-4-6-15)9-8-18-11(14-9)10-2-1-7-17-10/h1-2,7-8,13H,3-6H2 |
| InChIKey | PNBRAZZKJQNGPO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |