C13H15N3O2S — CID 119418759
1,4-diazepan-1-yl-[2-(furan-3-yl)-1,3-thiazol-4-yl]methanone (PubChem CID 119418759) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[2-(furan-3-yl)-1,3-thiazol-4-yl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[2-(furan-3-yl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 119418759 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1,4-diazepan-1-yl-[2-(furan-3-yl)-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(-c2ccoc2)n1)N1CCCNCC1 |
| InChI | InChI=1S/C13H15N3O2S/c17-13(16-5-1-3-14-4-6-16)11-9-19-12(15-11)10-2-7-18-8-10/h2,7-9,14H,1,3-6H2 |
| InChIKey | VJFDUSOHHVQMOA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |