C18H20N6O2S — CID 120833329
[2-(furan-3-yl)-1,3-thiazol-4-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 120833329) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is [2-(furan-3-yl)-1,3-thiazol-4-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [2-(furan-3-yl)-1,3-thiazol-4-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 120833329 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [2-(furan-3-yl)-1,3-thiazol-4-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1csc(-c2ccoc2)n1)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C18H20N6O2S/c25-18(14-11-27-17(20-14)13-3-8-26-10-13)23-5-1-12(2-6-23)16-22-21-15-9-19-4-7-24(15)16/h3,8,10-12,19H,1-2,4-7,9H2 |
| InChIKey | VJHFGHAGYMVLMM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |